C14H23NO2 — CID 143265861
4-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxyethyl]morpholine (PubChem CID 143265861) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 143265861 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxyethyl]morpholine |
| SMILES | C=C(C)/C=C\C(=C/C)OCCN1CCOCC1 |
| InChI | InChI=1S/C14H23NO2/c1-4-14(6-5-13(2)3)17-12-9-15-7-10-16-11-8-15/h4-6H,2,7-12H2,1,3H3/b6-5-,14-4- |
| InChIKey | HWBCIJMQBNDXBK-NPBZBYOLSA-N |
| XLogP | 2.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|