C27H40O3 — CID 143266144
6-methyl-2-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]oxepane;5-methyl-2-(4-methylphenyl)-1,3-dioxane (PubChem CID 143266144) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is 6-methyl-2-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]oxepane;5-methyl-2-(4-methylphenyl)-1,3-dioxane.
| Compound Name | 6-methyl-2-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]oxepane;5-methyl-2-(4-methylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 143266144 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 6-methyl-2-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]oxepane;5-methyl-2-(4-methylphenyl)-1,3-dioxane |
| SMILES | C=C/C=C(C)\C=C/CC1CCCC(C)CO1.Cc1ccc(C2OCC(C)CO2)cc1 |
| InChI | InChI=1S/C15H24O.C12H16O2/c1-4-7-13(2)8-5-10-15-11-6-9-14(3)12-16-15;1-9-3-5-11(6-4-9)12-13-7-10(2)8-14-12/h4-5,7-8,14-15H,1,6,9-12H2,2-3H3;3-6,10,12H,7-8H2,1-2H3/b8-5-,13-7-; |
| InChIKey | RDTDAGMMTDYHLS-OHSOMNBQSA-N |
| XLogP | 6.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|