C25H34N6O5S — CID 143266990
4-[(E)-C-(3a-methyl-4H-1,3-benzodioxol-5-yl)-N-[2-(diethylamino)ethoxy]carbonimidoyl]-2-amino-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 143266990) has the molecular formula C25H34N6O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is 4-[(E)-C-(3a-methyl-4H-1,3-benzodioxol-5-yl)-N-[2-(diethylamino)ethoxy]carbonimidoyl]-2-amino-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[(E)-C-(3a-methyl-4H-1,3-benzodioxol-5-yl)-N-[2-(diethylamino)ethoxy]carbonimidoyl]-2-amino-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 143266990 |
| Molecular Formula | C25H34N6O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 4-[(E)-C-(3a-methyl-4H-1,3-benzodioxol-5-yl)-N-[2-(diethylamino)ethoxy]carbonimidoyl]-2-amino-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)CCO/N=C(\C1=CC=C2OCOC2(C)C1)c1nc(N)nc2sc(C(=O)NCCOC)cc12 |
| InChI | InChI=1S/C25H34N6O5S/c1-5-31(6-2)10-12-36-30-20(16-7-8-19-25(3,14-16)35-15-34-19)21-17-13-18(22(32)27-9-11-33-4)37-23(17)29-24(26)28-21/h7-8,13H,5-6,9-12,14-15H2,1-4H3,(H,27,32)(H2,26,28,29)/b30-20+ |
| InChIKey | IYSDRTUKFUSXNG-TWKHWXDSSA-N |
| XLogP | 2.69 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|