C16H34N2O — CID 143267183
ethane;(3E,5E)-5-methoxy-N,3-dimethylocta-3,5,7-trien-2-amine;propan-1-amine (PubChem CID 143267183) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is ethane;(3E,5E)-5-methoxy-N,3-dimethylocta-3,5,7-trien-2-amine;propan-1-amine.
| Compound Name | ethane;(3E,5E)-5-methoxy-N,3-dimethylocta-3,5,7-trien-2-amine;propan-1-amine |
|---|---|
| PubChem CID | 143267183 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | ethane;(3E,5E)-5-methoxy-N,3-dimethylocta-3,5,7-trien-2-amine;propan-1-amine |
| SMILES | C=C/C=C(\C=C(/C)C(C)NC)OC.CC.CCCN |
| InChI | InChI=1S/C11H19NO.C3H9N.C2H6/c1-6-7-11(13-5)8-9(2)10(3)12-4;1-2-3-4;1-2/h6-8,10,12H,1H2,2-5H3;2-4H2,1H3;1-2H3/b9-8+,11-7+;; |
| InChIKey | WCUYLLQSNWRYSL-LGTGYRRZSA-N |
| XLogP | 3.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|