C21H31N — CID 143267185
ethane;14-ethyl-6,14-dimethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1,3(9),4,7,10-pentaene (PubChem CID 143267185) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is ethane;14-ethyl-6,14-dimethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1,3(9),4,7,10-pentaene.
| Compound Name | ethane;14-ethyl-6,14-dimethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1,3(9),4,7,10-pentaene |
|---|---|
| PubChem CID | 143267185 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | ethane;14-ethyl-6,14-dimethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1,3(9),4,7,10-pentaene |
| SMILES | CC.CCC1(C)CCc2cc3c(nc2CC1)C=CC(C)C=C3 |
| InChI | InChI=1S/C19H25N.C2H6/c1-4-19(3)11-9-16-13-15-7-5-14(2)6-8-17(15)20-18(16)10-12-19;1-2/h5-8,13-14H,4,9-12H2,1-3H3;1-2H3 |
| InChIKey | RZGRQLOHAMQDFE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |