About 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane
1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane (PubChem CID 143267650) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane.
Molecular Properties
| Compound Name | 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane |
| PubChem CID | 143267650 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane |
| SMILES | CC.CCC(O)Cc1ccc2c(c1)C=CCN2 |
| InChI | InChI=1S/C13H17NO.C2H6/c1-2-12(15)9-10-5-6-13-11(8-10)4-3-7-14-13;1-2/h3-6,8,12,14-15H,2,7,9H2,1H3;1-2H3 |
| InChIKey | CPSZVCGQNCVNBI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane?
The IUPAC name of 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane (CID 143267650) is 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane.
What is the SMILES notation for 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane?
The canonical SMILES for 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane is CC.CCC(O)Cc1ccc2c(c1)C=CCN2.
What is the InChIKey of 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane?
The InChIKey is CPSZVCGQNCVNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO.C2H6/c1-2-12(15)9-10-5-6-13-11(8-10)4-3-7-14-13;1-2/h3-6,8,12,14-15H,2,7,9H2,1H3;1-2H3.
What are the key properties of 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane?
1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane has a molecular weight of 233.35 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dihydroquinolin-6-yl)butan-2-ol;ethane is sourced from PubChem (CID 143267650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).