C14H21F3O2 — CID 143267662
ethane;1-[3-(trifluoromethoxy)phenyl]pentan-2-ol (PubChem CID 143267662) has the molecular formula C14H21F3O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethane;1-[3-(trifluoromethoxy)phenyl]pentan-2-ol.
| Compound Name | ethane;1-[3-(trifluoromethoxy)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 143267662 |
| Molecular Formula | C14H21F3O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethane;1-[3-(trifluoromethoxy)phenyl]pentan-2-ol |
| SMILES | CC.CCCC(O)Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O2.C2H6/c1-2-4-10(16)7-9-5-3-6-11(8-9)17-12(13,14)15;1-2/h3,5-6,8,10,16H,2,4,7H2,1H3;1-2H3 |
| InChIKey | BVORATLFYXEETG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |