C12H20OS — CID 143267705
5-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpentan-2-ol (PubChem CID 143267705) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 5-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpentan-2-ol.
| Compound Name | 5-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpentan-2-ol |
|---|---|
| PubChem CID | 143267705 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpentan-2-ol |
| SMILES | C=C/C=C(\C=C)CSCCCC(C)O |
| InChI | InChI=1S/C12H20OS/c1-4-7-12(5-2)10-14-9-6-8-11(3)13/h4-5,7,11,13H,1-2,6,8-10H2,3H3/b12-7+ |
| InChIKey | NSONERCAYCYNAI-KPKJPENVSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|