C28H42O7 — CID 143268403
(E)-3-[4-(2-hydroxyethoxy)-3-methylphenyl]prop-2-enoic acid;methanol;4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane (PubChem CID 143268403) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is (E)-3-[4-(2-hydroxyethoxy)-3-methylphenyl]prop-2-enoic acid;methanol;4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane.
| Compound Name | (E)-3-[4-(2-hydroxyethoxy)-3-methylphenyl]prop-2-enoic acid;methanol;4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 143268403 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (E)-3-[4-(2-hydroxyethoxy)-3-methylphenyl]prop-2-enoic acid;methanol;4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
| SMILES | CC(C)=CCC1OC1(C)C1CCCCC12CO2.CO.Cc1cc(/C=C/C(=O)O)ccc1OCCO |
| InChI | InChI=1S/C15H24O2.C12H14O4.CH4O/c1-11(2)7-8-13-14(3,17-13)12-6-4-5-9-15(12)10-16-15;1-9-8-10(3-5-12(14)15)2-4-11(9)16-7-6-13;1-2/h7,12-13H,4-6,8-10H2,1-3H3;2-5,8,13H,6-7H2,1H3,(H,14,15);2H,1H3/b;5-3+; |
| InChIKey | NJQJFURYCLEUSS-PTDWBMLLSA-N |
| XLogP | 4.53 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|