About benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate
benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate (PubChem CID 14326866) has the molecular formula C33H35NO3
and a molecular weight of 493.65 g/mol. Its IUPAC name is benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate.
Molecular Properties
| Compound Name | benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate |
| PubChem CID | 14326866 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate |
| SMILES | CC(O)C(Cc1ccccc1)N(CCC(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO3/c1-26(35)32(24-27-14-6-2-7-15-27)34(33(36)37-25-28-16-8-3-9-17-28)23-22-31(29-18-10-4-11-19-29)30-20-12-5-13-21-30/h2-21,26,31-32,35H,22-25H2,1H3 |
| InChIKey | MLVKUSMZNMDYCX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate?
The IUPAC name of benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate (CID 14326866) is benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate.
What is the SMILES notation for benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate?
The canonical SMILES for benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate is CC(O)C(Cc1ccccc1)N(CCC(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate?
The InChIKey is MLVKUSMZNMDYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H35NO3/c1-26(35)32(24-27-14-6-2-7-15-27)34(33(36)37-25-28-16-8-3-9-17-28)23-22-31(29-18-10-4-11-19-29)30-20-12-5-13-21-30/h2-21,26,31-32,35H,22-25H2,1H3.
What are the key properties of benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate?
benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate has a molecular weight of 493.65 g/mol, XLogP of 6.84, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(3,3-diphenylpropyl)-N-(3-hydroxy-1-phenylbutan-2-yl)carbamate is sourced from PubChem (CID 14326866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).