C16H19N — CID 143269261
(2Z,3Z,5Z)-2-(2-methylspiro[2.5]octa-4,6-dien-8-ylidene)hepta-3,5-dien-1-imine (PubChem CID 143269261) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is (2Z,3Z,5Z)-2-(2-methylspiro[2.5]octa-4,6-dien-8-ylidene)hepta-3,5-dien-1-imine.
| Compound Name | (2Z,3Z,5Z)-2-(2-methylspiro[2.5]octa-4,6-dien-8-ylidene)hepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 143269261 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2Z,3Z,5Z)-2-(2-methylspiro[2.5]octa-4,6-dien-8-ylidene)hepta-3,5-dien-1-imine |
| SMILES | [H]/N=C/C(/C=C\C=C/C)=C1/C=CC=CC12CC2C |
| InChI | InChI=1S/C16H19N/c1-3-4-5-8-14(12-17)15-9-6-7-10-16(15)11-13(16)2/h3-10,12-13,17H,11H2,1-2H3/b4-3-,8-5-,15-14-,17-12+ |
| InChIKey | WOGLYPLUZMFQSF-AERPJUEKSA-N |
| XLogP | 4.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|