C8H14N2O — CID 14326941
(E)-N-methoxy-1-(1,2,3,6-tetrahydropyridin-4-yl)ethanimine (PubChem CID 14326941) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (E)-N-methoxy-1-(1,2,3,6-tetrahydropyridin-4-yl)ethanimine.
| Compound Name | (E)-N-methoxy-1-(1,2,3,6-tetrahydropyridin-4-yl)ethanimine |
|---|---|
| PubChem CID | 14326941 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (E)-N-methoxy-1-(1,2,3,6-tetrahydropyridin-4-yl)ethanimine |
| SMILES | CO/N=C(\C)C1=CCNCC1 |
| InChI | InChI=1S/C8H14N2O/c1-7(10-11-2)8-3-5-9-6-4-8/h3,9H,4-6H2,1-2H3/b10-7+ |
| InChIKey | CXJXHZCZWSTORD-JXMROGBWSA-N |
| XLogP | 0.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|