C12H19NO2S — CID 143269479
4-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 143269479) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 143269479 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C=C/C=C\C=C(/C)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19NO2S/c1-3-4-5-6-12(2)11-13-7-9-16(14,15)10-8-13/h3-6H,1,7-11H2,2H3/b5-4-,12-6+ |
| InChIKey | XZVUCTDHJPJUEB-QENXGIAESA-N |
| XLogP | 1.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|