C30H36N8 — CID 143269788
N,N-dibenzyl-3-[4-(2-ethyl-2-methylhydrazinyl)phenyl]-5-piperazin-1-yl-1,2,4-triazin-6-amine (PubChem CID 143269788) has the molecular formula C30H36N8 and a molecular weight of 508.67 g/mol. Its IUPAC name is N,N-dibenzyl-3-[4-(2-ethyl-2-methylhydrazinyl)phenyl]-5-piperazin-1-yl-1,2,4-triazin-6-amine.
| Compound Name | N,N-dibenzyl-3-[4-(2-ethyl-2-methylhydrazinyl)phenyl]-5-piperazin-1-yl-1,2,4-triazin-6-amine |
|---|---|
| PubChem CID | 143269788 |
| Molecular Formula | C30H36N8 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | N,N-dibenzyl-3-[4-(2-ethyl-2-methylhydrazinyl)phenyl]-5-piperazin-1-yl-1,2,4-triazin-6-amine |
| SMILES | CCN(C)Nc1ccc(-c2nnc(N(Cc3ccccc3)Cc3ccccc3)c(N3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C30H36N8/c1-3-36(2)35-27-16-14-26(15-17-27)28-32-29(37-20-18-31-19-21-37)30(34-33-28)38(22-24-10-6-4-7-11-24)23-25-12-8-5-9-13-25/h4-17,31,35H,3,18-23H2,1-2H3 |
| InChIKey | JWQHNUNLNNKIDS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|