About 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine
2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine (PubChem CID 143269798) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine.
Molecular Properties
| Compound Name | 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine |
| PubChem CID | 143269798 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine |
| SMILES | C=C(F)/C(=C\C=C/C)CC1CNCCN1 |
| InChI | InChI=1S/C12H19FN2/c1-3-4-5-11(10(2)13)8-12-9-14-6-7-15-12/h3-5,12,14-15H,2,6-9H2,1H3/b4-3-,11-5- |
| InChIKey | MHYKQIKBMKDFST-RUTRJIIFSA-N |
| XLogP | 1.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine?
The IUPAC name of 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine (CID 143269798) is 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine.
What is the SMILES notation for 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine?
The canonical SMILES for 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine is C=C(F)/C(=C\C=C/C)CC1CNCCN1.
What is the InChIKey of 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine?
The InChIKey is MHYKQIKBMKDFST-RUTRJIIFSA-N. The full InChI is InChI=1S/C12H19FN2/c1-3-4-5-11(10(2)13)8-12-9-14-6-7-15-12/h3-5,12,14-15H,2,6-9H2,1H3/b4-3-,11-5-.
What are the key properties of 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine?
2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine has a molecular weight of 210.30 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z,4Z)-2-(1-fluoroethenyl)hexa-2,4-dienyl]piperazine is sourced from PubChem (CID 143269798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).