About 4-cyclohexylphenol
4-cyclohexylphenol (PubChem CID 14327) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-cyclohexylphenol.
Molecular Properties
| Compound Name | 4-cyclohexylphenol |
| PubChem CID | 14327 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-cyclohexylphenol |
| SMILES | Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,13H,1-5H2 |
| InChIKey | OAHMVZYHIJQTQC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylphenol?
The IUPAC name of 4-cyclohexylphenol (CID 14327) is 4-cyclohexylphenol.
What is the SMILES notation for 4-cyclohexylphenol?
The canonical SMILES for 4-cyclohexylphenol is Oc1ccc(C2CCCCC2)cc1.
What is the InChIKey of 4-cyclohexylphenol?
The InChIKey is OAHMVZYHIJQTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,13H,1-5H2.
What are the key properties of 4-cyclohexylphenol?
4-cyclohexylphenol has a molecular weight of 176.26 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylphenol is sourced from PubChem (CID 14327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).