C21H36O6 — CID 143270573
2-[(2R,5S,6S,9R)-9-[(2S,3S)-1,3-dihydroxy-2-methylhept-6-en-2-yl]-2-(hydroxymethyl)-6-methyl-1-oxaspiro[4.5]decan-2-yl]acetic acid (PubChem CID 143270573) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-[(2R,5S,6S,9R)-9-[(2S,3S)-1,3-dihydroxy-2-methylhept-6-en-2-yl]-2-(hydroxymethyl)-6-methyl-1-oxaspiro[4.5]decan-2-yl]acetic acid.
| Compound Name | 2-[(2R,5S,6S,9R)-9-[(2S,3S)-1,3-dihydroxy-2-methylhept-6-en-2-yl]-2-(hydroxymethyl)-6-methyl-1-oxaspiro[4.5]decan-2-yl]acetic acid |
|---|---|
| PubChem CID | 143270573 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[(2R,5S,6S,9R)-9-[(2S,3S)-1,3-dihydroxy-2-methylhept-6-en-2-yl]-2-(hydroxymethyl)-6-methyl-1-oxaspiro[4.5]decan-2-yl]acetic acid |
| SMILES | C=CCC[C@H](O)[C@](C)(CO)[C@@H]1CC[C@H](C)[C@]2(CC[C@](CO)(CC(=O)O)O2)C1 |
| InChI | InChI=1S/C21H36O6/c1-4-5-6-17(24)19(3,13-22)16-8-7-15(2)21(11-16)10-9-20(14-23,27-21)12-18(25)26/h4,15-17,22-24H,1,5-14H2,2-3H3,(H,25,26)/t15-,16+,17-,19+,20+,21-/m0/s1 |
| InChIKey | RIAAUKSWKJQDFS-NUKYBCBUSA-N |
| XLogP | 2.50 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|