C22H30O5 — CID 143270652
3-[(7S,8aS)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,3'-oxirane]-2'-yl]-2,5,6-trihydroxybenzaldehyde (PubChem CID 143270652) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[(7S,8aS)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,3'-oxirane]-2'-yl]-2,5,6-trihydroxybenzaldehyde.
| Compound Name | 3-[(7S,8aS)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,3'-oxirane]-2'-yl]-2,5,6-trihydroxybenzaldehyde |
|---|---|
| PubChem CID | 143270652 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[(7S,8aS)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,3'-oxirane]-2'-yl]-2,5,6-trihydroxybenzaldehyde |
| SMILES | CC1CCC2C(C)(C)CCC[C@]2(C)C12OC2c1cc(O)c(O)c(C=O)c1O |
| InChI | InChI=1S/C22H30O5/c1-12-6-7-16-20(2,3)8-5-9-21(16,4)22(12)19(27-22)13-10-15(24)18(26)14(11-23)17(13)25/h10-12,16,19,24-26H,5-9H2,1-4H3/t12?,16?,19?,21-,22?/m0/s1 |
| InChIKey | YGUULSBZHWHVTQ-DDNGMCJMSA-N |
| XLogP | 4.69 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|