About 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole
3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole (PubChem CID 143270777) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole |
| PubChem CID | 143270777 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole |
| SMILES | C=C/C(=C\C1=C(C)CNC1)OC1CCOCC1 |
| InChI | InChI=1S/C14H21NO2/c1-3-13(8-12-10-15-9-11(12)2)17-14-4-6-16-7-5-14/h3,8,14-15H,1,4-7,9-10H2,2H3/b13-8+ |
| InChIKey | HEMLENFAZKTYJW-MDWZMJQESA-N |
| XLogP | 2.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole?
The IUPAC name of 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole (CID 143270777) is 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole is C=C/C(=C\C1=C(C)CNC1)OC1CCOCC1.
What is the InChIKey of 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole?
The InChIKey is HEMLENFAZKTYJW-MDWZMJQESA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-13(8-12-10-15-9-11(12)2)17-14-4-6-16-7-5-14/h3,8,14-15H,1,4-7,9-10H2,2H3/b13-8+.
What are the key properties of 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole?
3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole has a molecular weight of 235.33 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(1E)-2-(oxan-4-yloxy)buta-1,3-dienyl]-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 143270777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).