About ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate (PubChem CID 143271981) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate.
Molecular Properties
| Compound Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate |
| PubChem CID | 143271981 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)N(C)C1CCNCC1.CC |
| InChI | InChI=1S/C14H22N2O2.C2H6/c1-4-6-12(5-2)11-18-14(17)16(3)13-7-9-15-10-8-13;1-2/h4-6,13,15H,1-2,7-11H2,3H3;1-2H3/b12-6+; |
| InChIKey | XDDZGVRNSAQPAA-WXIWBVQFSA-N |
| XLogP | 3.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate?
The IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate (CID 143271981) is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate.
What is the SMILES notation for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate?
The canonical SMILES for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate is C=C/C=C(\C=C)COC(=O)N(C)C1CCNCC1.CC.
What is the InChIKey of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate?
The InChIKey is XDDZGVRNSAQPAA-WXIWBVQFSA-N. The full InChI is InChI=1S/C14H22N2O2.C2H6/c1-4-6-12(5-2)11-18-14(17)16(3)13-7-9-15-10-8-13;1-2/h4-6,13,15H,1-2,7-11H2,3H3;1-2H3/b12-6+;.
What are the key properties of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate?
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate has a molecular weight of 280.41 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate is sourced from PubChem (CID 143271981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).