C31H36N2O4 — CID 143272038
4-(3,4-diethoxycyclohexyl)-N-(4,6-diphenyl-2-pyridinyl)-4-oxobutanamide (PubChem CID 143272038) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-(3,4-diethoxycyclohexyl)-N-(4,6-diphenyl-2-pyridinyl)-4-oxobutanamide.
| Compound Name | 4-(3,4-diethoxycyclohexyl)-N-(4,6-diphenyl-2-pyridinyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 143272038 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 4-(3,4-diethoxycyclohexyl)-N-(4,6-diphenyl-2-pyridinyl)-4-oxobutanamide |
| SMILES | CCOC1CCC(C(=O)CCC(=O)Nc2cc(-c3ccccc3)cc(-c3ccccc3)n2)CC1OCC |
| InChI | InChI=1S/C31H36N2O4/c1-3-36-28-17-15-24(20-29(28)37-4-2)27(34)16-18-31(35)33-30-21-25(22-11-7-5-8-12-22)19-26(32-30)23-13-9-6-10-14-23/h5-14,19,21,24,28-29H,3-4,15-18,20H2,1-2H3,(H,32,33,35) |
| InChIKey | VDSZTTUBAJHZGF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |