About 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine
4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine (PubChem CID 143272039) has the molecular formula C30H30N2O3
and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine |
| PubChem CID | 143272039 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine |
| SMILES | CCOc1cccc(C(=O)CCC=O)c1.CNc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N2.C12H14O3/c1-19-18-13-16(14-8-4-2-5-9-14)12-17(20-18)15-10-6-3-7-11-15;1-2-15-11-6-3-5-10(9-11)12(14)7-4-8-13/h2-13H,1H3,(H,19,20);3,5-6,8-9H,2,4,7H2,1H3 |
| InChIKey | DDFXSPZVRVCRFH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine?
The IUPAC name of 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine (CID 143272039) is 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine.
What is the SMILES notation for 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine?
The canonical SMILES for 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine is CCOc1cccc(C(=O)CCC=O)c1.CNc1cc(-c2ccccc2)cc(-c2ccccc2)n1.
What is the InChIKey of 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine?
The InChIKey is DDFXSPZVRVCRFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2.C12H14O3/c1-19-18-13-16(14-8-4-2-5-9-14)12-17(20-18)15-10-6-3-7-11-15;1-2-15-11-6-3-5-10(9-11)12(14)7-4-8-13/h2-13H,1H3,(H,19,20);3,5-6,8-9H,2,4,7H2,1H3.
What are the key properties of 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine?
4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine has a molecular weight of 466.58 g/mol, XLogP of 6.70, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethoxyphenyl)-4-oxobutanal;N-methyl-4,6-diphenylpyridin-2-amine is sourced from PubChem (CID 143272039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).