C20H21NO2 — CID 143272081
2-phenylcyclohexa-1,5-diene-1-carboxylic acid;phenylmethanamine (PubChem CID 143272081) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-phenylcyclohexa-1,5-diene-1-carboxylic acid;phenylmethanamine.
| Compound Name | 2-phenylcyclohexa-1,5-diene-1-carboxylic acid;phenylmethanamine |
|---|---|
| PubChem CID | 143272081 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-phenylcyclohexa-1,5-diene-1-carboxylic acid;phenylmethanamine |
| SMILES | NCc1ccccc1.O=C(O)C1=C(c2ccccc2)CCC=C1 |
| InChI | InChI=1S/C13H12O2.C7H9N/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;8-6-7-4-2-1-3-5-7/h1-3,5-7,9H,4,8H2,(H,14,15);1-5H,6,8H2 |
| InChIKey | UAHKPAAQOCPNLY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |