2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride

C7H16ClNO — CID 14327232

IUPAC2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride
SMILESC=CC[N+](C)(C)CCO.[Cl-]
InChIInChI=1S/C7H16NO.ClH/c1-4-5-8(2,3)6-7-9;/h4,9H,1,5-7H2,2-3H3;1H/q+1;/p-1
InChIKeyYJLOJTQJARFPMO-UHFFFAOYSA-M
MW165.66 g/mol
LogP-2.75
Rot. Bonds4

About 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride

2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride (PubChem CID 14327232) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride.

Molecular Properties

Compound Name2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride
PubChem CID14327232
Molecular FormulaC7H16ClNO
Molecular Weight165.66 g/mol
Exact Mass165.09
IUPAC Name2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride
SMILESC=CC[N+](C)(C)CCO.[Cl-]
InChIInChI=1S/C7H16NO.ClH/c1-4-5-8(2,3)6-7-9;/h4,9H,1,5-7H2,2-3H3;1H/q+1;/p-1
InChIKeyYJLOJTQJARFPMO-UHFFFAOYSA-M
XLogP-2.75
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.66
LogP ≤ 5-2.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride?
The IUPAC name of 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride (CID 14327232) is 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride.
What is the SMILES notation for 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride?
The canonical SMILES for 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride is C=CC[N+](C)(C)CCO.[Cl-].
What is the InChIKey of 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride?
The InChIKey is YJLOJTQJARFPMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16NO.ClH/c1-4-5-8(2,3)6-7-9;/h4,9H,1,5-7H2,2-3H3;1H/q+1;/p-1.
What are the key properties of 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride?
2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride has a molecular weight of 165.66 g/mol, XLogP of -2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl-dimethyl-prop-2-enylazanium chloride is sourced from PubChem (CID 14327232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).