C32H32Cl2N2O4 — CID 143272371
1-[(3,4-dichlorophenyl)methyl]-1-[2-(4-phenylphenyl)ethyl]urea;3-phenylmethoxypropanoic acid (PubChem CID 143272371) has the molecular formula C32H32Cl2N2O4 and a molecular weight of 579.52 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1-[2-(4-phenylphenyl)ethyl]urea;3-phenylmethoxypropanoic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1-[2-(4-phenylphenyl)ethyl]urea;3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 143272371 |
| Molecular Formula | C32H32Cl2N2O4 |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1-[2-(4-phenylphenyl)ethyl]urea;3-phenylmethoxypropanoic acid |
| SMILES | NC(=O)N(CCc1ccc(-c2ccccc2)cc1)Cc1ccc(Cl)c(Cl)c1.O=C(O)CCOCc1ccccc1 |
| InChI | InChI=1S/C22H20Cl2N2O.C10H12O3/c23-20-11-8-17(14-21(20)24)15-26(22(25)27)13-12-16-6-9-19(10-7-16)18-4-2-1-3-5-18;11-10(12)6-7-13-8-9-4-2-1-3-5-9/h1-11,14H,12-13,15H2,(H2,25,27);1-5H,6-8H2,(H,11,12) |
| InChIKey | UKQQJDVQPRPOAT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|