C26H43N5O3 — CID 143272448
ethane;2-[4-[4-[(3E,5E,7Z)-5-ethenyl-9-hydroxy-6-methylnona-3,5,7-trien-4-yl]piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 143272448) has the molecular formula C26H43N5O3 and a molecular weight of 473.66 g/mol. Its IUPAC name is ethane;2-[4-[4-[(3E,5E,7Z)-5-ethenyl-9-hydroxy-6-methylnona-3,5,7-trien-4-yl]piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | ethane;2-[4-[4-[(3E,5E,7Z)-5-ethenyl-9-hydroxy-6-methylnona-3,5,7-trien-4-yl]piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 143272448 |
| Molecular Formula | C26H43N5O3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | ethane;2-[4-[4-[(3E,5E,7Z)-5-ethenyl-9-hydroxy-6-methylnona-3,5,7-trien-4-yl]piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | C=CC(/C(=C\CC)N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1)=C(C)\C=C/CO.CC |
| InChI | InChI=1S/C24H37N5O3.C2H6/c1-5-10-22(21(6-2)20(3)11-9-18-30)28-16-14-27(15-17-28)12-7-8-13-29-24(32)26(4)23(31)19-25-29;1-2/h6,9-11,19,30H,2,5,7-8,12-18H2,1,3-4H3;1-2H3/b11-9-,21-20+,22-10+; |
| InChIKey | VUVMHCKRDFDWER-AZGYPPIVSA-N |
| XLogP | 2.71 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|