C22H33N5O2 — CID 143272452
4-methyl-2-[4-[4-[(3E)-8-methylnona-3,8-dien-5-yn-3-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 143272452) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-methyl-2-[4-[4-[(3E)-8-methylnona-3,8-dien-5-yn-3-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 4-methyl-2-[4-[4-[(3E)-8-methylnona-3,8-dien-5-yn-3-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 143272452 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 4-methyl-2-[4-[4-[(3E)-8-methylnona-3,8-dien-5-yn-3-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | C=C(C)CC#C/C=C(\CC)N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1 |
| InChI | InChI=1S/C22H33N5O2/c1-5-20(11-7-6-10-19(2)3)26-16-14-25(15-17-26)12-8-9-13-27-22(29)24(4)21(28)18-23-27/h11,18H,2,5,8-10,12-17H2,1,3-4H3/b20-11+ |
| InChIKey | HRUMDPCJGJUXOO-RGVLZGJSSA-N |
| XLogP | 1.60 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|