About 3-amino-2,3-dihydro-1H-indole-6-carbonitrile
3-amino-2,3-dihydro-1H-indole-6-carbonitrile (PubChem CID 143272834) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-amino-2,3-dihydro-1H-indole-6-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-2,3-dihydro-1H-indole-6-carbonitrile |
| PubChem CID | 143272834 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3-amino-2,3-dihydro-1H-indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NCC2N |
| InChI | InChI=1S/C9H9N3/c10-4-6-1-2-7-8(11)5-12-9(7)3-6/h1-3,8,12H,5,11H2 |
| InChIKey | FBWMBWDFJZYVRT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,3-dihydro-1H-indole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,3-dihydro-1H-indole-6-carbonitrile?
The IUPAC name of 3-amino-2,3-dihydro-1H-indole-6-carbonitrile (CID 143272834) is 3-amino-2,3-dihydro-1H-indole-6-carbonitrile.
What is the SMILES notation for 3-amino-2,3-dihydro-1H-indole-6-carbonitrile?
The canonical SMILES for 3-amino-2,3-dihydro-1H-indole-6-carbonitrile is N#Cc1ccc2c(c1)NCC2N.
What is the InChIKey of 3-amino-2,3-dihydro-1H-indole-6-carbonitrile?
The InChIKey is FBWMBWDFJZYVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-4-6-1-2-7-8(11)5-12-9(7)3-6/h1-3,8,12H,5,11H2.
What are the key properties of 3-amino-2,3-dihydro-1H-indole-6-carbonitrile?
3-amino-2,3-dihydro-1H-indole-6-carbonitrile has a molecular weight of 159.19 g/mol, XLogP of 0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,3-dihydro-1H-indole-6-carbonitrile is sourced from PubChem (CID 143272834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).