C19H28N2O2 — CID 143273134
3-amino-4-(7-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)cyclobut-3-ene-1,2-dione;ethane (PubChem CID 143273134) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-amino-4-(7-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)cyclobut-3-ene-1,2-dione;ethane.
| Compound Name | 3-amino-4-(7-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)cyclobut-3-ene-1,2-dione;ethane |
|---|---|
| PubChem CID | 143273134 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-amino-4-(7-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)cyclobut-3-ene-1,2-dione;ethane |
| SMILES | CC.CC.CCc1ccc2c(c1)CN(c1c(N)c(=O)c1=O)CC2 |
| InChI | InChI=1S/C15H16N2O2.2C2H6/c1-2-9-3-4-10-5-6-17(8-11(10)7-9)13-12(16)14(18)15(13)19;2*1-2/h3-4,7H,2,5-6,8,16H2,1H3;2*1-2H3 |
| InChIKey | QWHGHJRHEVZNCR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|