C11H13N5 — CID 143273250
(1S)-5-(2-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 143273250) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is (1S)-5-(2-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-5-(2-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 143273250 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (1S)-5-(2-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cn1nnc(-c2ccc3c(c2)CC[C@@H]3N)n1 |
| InChI | InChI=1S/C11H13N5/c1-16-14-11(13-15-16)8-2-4-9-7(6-8)3-5-10(9)12/h2,4,6,10H,3,5,12H2,1H3/t10-/m0/s1 |
| InChIKey | QWKGQRQJXCFDET-JTQLQIEISA-N |
| XLogP | 0.82 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |