C17H21ClN2OS — CID 143274209
(E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine (PubChem CID 143274209) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine.
| Compound Name | (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143274209 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(C)s1.O=CC/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C10H9ClO.C7H12N2S/c11-10-7-2-1-5-9(10)6-3-4-8-12;1-3-4-8-7-9-5-6(2)10-7/h1-3,5-8H,4H2;5H,3-4H2,1-2H3,(H,8,9)/b6-3+; |
| InChIKey | CVLKRFGHSKBTHM-ZIKNSQGESA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|