About (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine
(E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine (PubChem CID 143274209) has the molecular formula C17H21ClN2OS
and a molecular weight of 336.89 g/mol. Its IUPAC name is (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine |
| PubChem CID | 143274209 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(C)s1.O=CC/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C10H9ClO.C7H12N2S/c11-10-7-2-1-5-9(10)6-3-4-8-12;1-3-4-8-7-9-5-6(2)10-7/h1-3,5-8H,4H2;5H,3-4H2,1-2H3,(H,8,9)/b6-3+; |
| InChIKey | CVLKRFGHSKBTHM-ZIKNSQGESA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine?
The IUPAC name of (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine (CID 143274209) is (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine.
What is the SMILES notation for (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine?
The canonical SMILES for (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine is CCCNc1ncc(C)s1.O=CC/C=C/c1ccccc1Cl.
What is the InChIKey of (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine?
The InChIKey is CVLKRFGHSKBTHM-ZIKNSQGESA-N. The full InChI is InChI=1S/C10H9ClO.C7H12N2S/c11-10-7-2-1-5-9(10)6-3-4-8-12;1-3-4-8-7-9-5-6(2)10-7/h1-3,5-8H,4H2;5H,3-4H2,1-2H3,(H,8,9)/b6-3+;.
What are the key properties of (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine?
(E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine has a molecular weight of 336.89 g/mol, XLogP of 5.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2-chlorophenyl)but-3-enal;5-methyl-N-propyl-1,3-thiazol-2-amine is sourced from PubChem (CID 143274209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).