C8H8F8N2O4S — CID 143274476
1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 143274476) has the molecular formula C8H8F8N2O4S and a molecular weight of 380.21 g/mol. Its IUPAC name is 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 143274476 |
| Molecular Formula | C8H8F8N2O4S |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | C[NH+]1C=CN=C1.O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F8O4S.C4H6N2/c5-1(2(6,7)17(13,14)15)16-4(11,12)3(8,9)10;1-6-3-2-5-4-6/h1H,(H,13,14,15);2-4H,1H3 |
| InChIKey | YCRFGVUKVYIXMG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|