About (5E)-5-methoxy-4-methylideneocta-5,7-dienal
(5E)-5-methoxy-4-methylideneocta-5,7-dienal (PubChem CID 143274837) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (5E)-5-methoxy-4-methylideneocta-5,7-dienal.
Molecular Properties
| Compound Name | (5E)-5-methoxy-4-methylideneocta-5,7-dienal |
| PubChem CID | 143274837 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (5E)-5-methoxy-4-methylideneocta-5,7-dienal |
| SMILES | C=C/C=C(/OC)C(=C)CCC=O |
| InChI | InChI=1S/C10H14O2/c1-4-6-10(12-3)9(2)7-5-8-11/h4,6,8H,1-2,5,7H2,3H3/b10-6+ |
| InChIKey | PJSVNLAOHOHPDM-UXBLZVDNSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-methoxy-4-methylideneocta-5,7-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-methoxy-4-methylideneocta-5,7-dienal?
The IUPAC name of (5E)-5-methoxy-4-methylideneocta-5,7-dienal (CID 143274837) is (5E)-5-methoxy-4-methylideneocta-5,7-dienal.
What is the SMILES notation for (5E)-5-methoxy-4-methylideneocta-5,7-dienal?
The canonical SMILES for (5E)-5-methoxy-4-methylideneocta-5,7-dienal is C=C/C=C(/OC)C(=C)CCC=O.
What is the InChIKey of (5E)-5-methoxy-4-methylideneocta-5,7-dienal?
The InChIKey is PJSVNLAOHOHPDM-UXBLZVDNSA-N. The full InChI is InChI=1S/C10H14O2/c1-4-6-10(12-3)9(2)7-5-8-11/h4,6,8H,1-2,5,7H2,3H3/b10-6+.
What are the key properties of (5E)-5-methoxy-4-methylideneocta-5,7-dienal?
(5E)-5-methoxy-4-methylideneocta-5,7-dienal has a molecular weight of 166.22 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-methoxy-4-methylideneocta-5,7-dienal is sourced from PubChem (CID 143274837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).