About 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid
3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid (PubChem CID 143275267) has the molecular formula C13H21N3O5S
and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid |
| PubChem CID | 143275267 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid |
| SMILES | O=[N+]([O-])C1=CC=C(N2CCN(CCCS(=O)(=O)O)CC2)CC1 |
| InChI | InChI=1S/C13H21N3O5S/c17-16(18)13-4-2-12(3-5-13)15-9-7-14(8-10-15)6-1-11-22(19,20)21/h2,4H,1,3,5-11H2,(H,19,20,21) |
| InChIKey | AUSYLBMKEDWUGH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid?
The IUPAC name of 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid (CID 143275267) is 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid.
What is the SMILES notation for 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid?
The canonical SMILES for 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid is O=[N+]([O-])C1=CC=C(N2CCN(CCCS(=O)(=O)O)CC2)CC1.
What is the InChIKey of 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid?
The InChIKey is AUSYLBMKEDWUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O5S/c17-16(18)13-4-2-12(3-5-13)15-9-7-14(8-10-15)6-1-11-22(19,20)21/h2,4H,1,3,5-11H2,(H,19,20,21).
What are the key properties of 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid?
3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid has a molecular weight of 331.39 g/mol, XLogP of 0.72, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-nitrocyclohexa-1,3-dien-1-yl)piperazin-1-yl]propane-1-sulfonic acid is sourced from PubChem (CID 143275267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).