C17H26ClNOS — CID 143275279
1-[1-(4-chlorophenyl)ethyl]-N-(3-hydroxysulfanylpropyl)cyclohexan-1-amine (PubChem CID 143275279) has the molecular formula C17H26ClNOS and a molecular weight of 327.92 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-N-(3-hydroxysulfanylpropyl)cyclohexan-1-amine.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-N-(3-hydroxysulfanylpropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 143275279 |
| Molecular Formula | C17H26ClNOS |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-N-(3-hydroxysulfanylpropyl)cyclohexan-1-amine |
| SMILES | CC(c1ccc(Cl)cc1)C1(NCCCSO)CCCCC1 |
| InChI | InChI=1S/C17H26ClNOS/c1-14(15-6-8-16(18)9-7-15)17(10-3-2-4-11-17)19-12-5-13-21-20/h6-9,14,19-20H,2-5,10-13H2,1H3 |
| InChIKey | VRRYYZOERLGUQD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|