C28H36O2 — CID 143275540
3,3-dimethyl-9,10-dihydro-8H-benzo[f]chromen-7-one;(3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene (PubChem CID 143275540) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is 3,3-dimethyl-9,10-dihydro-8H-benzo[f]chromen-7-one;(3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene.
| Compound Name | 3,3-dimethyl-9,10-dihydro-8H-benzo[f]chromen-7-one;(3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 143275540 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 3,3-dimethyl-9,10-dihydro-8H-benzo[f]chromen-7-one;(3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene |
| SMILES | C=C(C)/C=C\C=C/CCC=C(C)C.CC1(C)C=Cc2c(ccc3c2CCCC3=O)O1 |
| InChI | InChI=1S/C15H16O2.C13H20/c1-15(2)9-8-12-10-4-3-5-13(16)11(10)6-7-14(12)17-15;1-12(2)10-8-6-5-7-9-11-13(3)4/h6-9H,3-5H2,1-2H3;5-6,8,10-11H,1,7,9H2,2-4H3/b;6-5-,10-8- |
| InChIKey | XORDZVGZWCOPBI-HXTFECAHSA-N |
| XLogP | 7.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|