C17H18N2O3S — CID 143275585
(3Z)-6-methylhepta-1,3,5-triene;2-pyridin-3-yloxy-1,3-thiazole-5-carboxylic acid (PubChem CID 143275585) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (3Z)-6-methylhepta-1,3,5-triene;2-pyridin-3-yloxy-1,3-thiazole-5-carboxylic acid.
| Compound Name | (3Z)-6-methylhepta-1,3,5-triene;2-pyridin-3-yloxy-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 143275585 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (3Z)-6-methylhepta-1,3,5-triene;2-pyridin-3-yloxy-1,3-thiazole-5-carboxylic acid |
| SMILES | C=C/C=C\C=C(C)C.O=C(O)c1cnc(Oc2cccnc2)s1 |
| InChI | InChI=1S/C9H6N2O3S.C8H12/c12-8(13)7-5-11-9(15-7)14-6-2-1-3-10-4-6;1-4-5-6-7-8(2)3/h1-5H,(H,12,13);4-7H,1H2,2-3H3/b;6-5- |
| InChIKey | SEUPGSLFORCBKP-JXGYXAOLSA-N |
| XLogP | 4.72 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|