C8H15NO2 — CID 143275634
3,4-dimethyl-2,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazole (PubChem CID 143275634) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 3,4-dimethyl-2,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazole.
| Compound Name | 3,4-dimethyl-2,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazole |
|---|---|
| PubChem CID | 143275634 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3,4-dimethyl-2,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazole |
| SMILES | CC1OCCC2OCN(C)C12 |
| InChI | InChI=1S/C8H15NO2/c1-6-8-7(3-4-10-6)11-5-9(8)2/h6-8H,3-5H2,1-2H3 |
| InChIKey | LXPYISNAHJCIIF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |