C26H32N3O6P — CID 143276126
[3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-[5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2,5-dioxopyrrolidin-1-yl]methyl dihydrogen phosphate;ethane (PubChem CID 143276126) has the molecular formula C26H32N3O6P and a molecular weight of 513.53 g/mol. Its IUPAC name is [3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-[5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2,5-dioxopyrrolidin-1-yl]methyl dihydrogen phosphate;ethane.
| Compound Name | [3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-[5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2,5-dioxopyrrolidin-1-yl]methyl dihydrogen phosphate;ethane |
|---|---|
| PubChem CID | 143276126 |
| Molecular Formula | C26H32N3O6P |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-[5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2,5-dioxopyrrolidin-1-yl]methyl dihydrogen phosphate;ethane |
| SMILES | C/C=C\c1c(C2C(=O)N(COP(=O)(O)O)C(=O)C2c2cn3c4c(cccc24)CCC3)c[nH]c1C.CC |
| InChI | InChI=1S/C24H26N3O6P.C2H6/c1-3-6-16-14(2)25-11-18(16)20-21(24(29)27(23(20)28)13-33-34(30,31)32)19-12-26-10-5-8-15-7-4-9-17(19)22(15)26;1-2/h3-4,6-7,9,11-12,20-21,25H,5,8,10,13H2,1-2H3,(H2,30,31,32);1-2H3/b6-3-; |
| InChIKey | QGGPESPBXWCZLZ-AQPBACSKSA-N |
| XLogP | 4.59 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|