C14H17F2OP — CID 143276183
4-[(2E,4E)-5-[difluoro(phosphanyl)methyl]hepta-2,4,6-trien-2-yl]cyclohexa-1,5-dien-1-ol (PubChem CID 143276183) has the molecular formula C14H17F2OP and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-[(2E,4E)-5-[difluoro(phosphanyl)methyl]hepta-2,4,6-trien-2-yl]cyclohexa-1,5-dien-1-ol.
| Compound Name | 4-[(2E,4E)-5-[difluoro(phosphanyl)methyl]hepta-2,4,6-trien-2-yl]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 143276183 |
| Molecular Formula | C14H17F2OP |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[(2E,4E)-5-[difluoro(phosphanyl)methyl]hepta-2,4,6-trien-2-yl]cyclohexa-1,5-dien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)C1C=CC(O)=CC1)C(F)(F)P |
| InChI | InChI=1S/C14H17F2OP/c1-3-12(14(15,16)18)7-4-10(2)11-5-8-13(17)9-6-11/h3-5,7-9,11,17H,1,6,18H2,2H3/b10-4+,12-7+ |
| InChIKey | ZYFMABKGNFCLFO-CMLRWQBOSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|