C24H26F3NO4S — CID 143276196
3-[(5-ethylthiophene-2-carbonyl)amino]propanoic acid;(3E,5Z)-7-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-yn-4-ol (PubChem CID 143276196) has the molecular formula C24H26F3NO4S and a molecular weight of 481.54 g/mol. Its IUPAC name is 3-[(5-ethylthiophene-2-carbonyl)amino]propanoic acid;(3E,5Z)-7-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-yn-4-ol.
| Compound Name | 3-[(5-ethylthiophene-2-carbonyl)amino]propanoic acid;(3E,5Z)-7-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 143276196 |
| Molecular Formula | C24H26F3NO4S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 3-[(5-ethylthiophene-2-carbonyl)amino]propanoic acid;(3E,5Z)-7-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-3,5-dien-1-yn-4-ol |
| SMILES | C#C/C=C(O)\C=C/CC1=CCC(C(F)(F)F)C=C1.CCc1ccc(C(=O)NCCC(=O)O)s1 |
| InChI | InChI=1S/C14H13F3O.C10H13NO3S/c1-2-4-13(18)6-3-5-11-7-9-12(10-8-11)14(15,16)17;1-2-7-3-4-8(15-7)10(14)11-6-5-9(12)13/h1,3-4,6-9,12,18H,5,10H2;3-4H,2,5-6H2,1H3,(H,11,14)(H,12,13)/b6-3-,13-4+; |
| InChIKey | QDDFVMVJTDUSSK-SSRSBMHOSA-N |
| XLogP | 5.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|