About 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol
4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol (PubChem CID 143276306) has the molecular formula C15H14F2O
and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol |
| PubChem CID | 143276306 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(C)c1-c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C15H14F2O/c1-9-7-13(18)8-10(2)14(9)11-3-5-12(6-4-11)15(16)17/h3-8,15,18H,1-2H3 |
| InChIKey | MVJUIVOWIWLCFB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol?
The IUPAC name of 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol (CID 143276306) is 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol.
What is the SMILES notation for 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol?
The canonical SMILES for 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol is Cc1cc(O)cc(C)c1-c1ccc(C(F)F)cc1.
What is the InChIKey of 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol?
The InChIKey is MVJUIVOWIWLCFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2O/c1-9-7-13(18)8-10(2)14(9)11-3-5-12(6-4-11)15(16)17/h3-8,15,18H,1-2H3.
What are the key properties of 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol?
4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol has a molecular weight of 248.27 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(difluoromethyl)phenyl]-3,5-dimethylphenol is sourced from PubChem (CID 143276306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).