C19H19N7 — CID 143276370
3-methyl-1H-indole;1-methyl-2-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)hydrazine (PubChem CID 143276370) has the molecular formula C19H19N7 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-methyl-1H-indole;1-methyl-2-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)hydrazine.
| Compound Name | 3-methyl-1H-indole;1-methyl-2-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)hydrazine |
|---|---|
| PubChem CID | 143276370 |
| Molecular Formula | C19H19N7 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-methyl-1H-indole;1-methyl-2-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)hydrazine |
| SMILES | CNNc1ncnc2nn3ccccc3c12.Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H10N6.C9H9N/c1-11-14-9-8-7-4-2-3-5-16(7)15-10(8)13-6-12-9;1-7-6-10-9-5-3-2-4-8(7)9/h2-6,11H,1H3,(H,12,13,14,15);2-6,10H,1H3 |
| InChIKey | NEKFCWHEFKUQCN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|