About methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate
methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate (PubChem CID 143276796) has the molecular formula C11H14FNO3
and a molecular weight of 227.23 g/mol. Its IUPAC name is methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate.
Molecular Properties
| Compound Name | methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate |
| PubChem CID | 143276796 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate |
| SMILES | C=C/C=C(\C=C)CC(NC(=O)F)C(=O)OC |
| InChI | InChI=1S/C11H14FNO3/c1-4-6-8(5-2)7-9(10(14)16-3)13-11(12)15/h4-6,9H,1-2,7H2,3H3,(H,13,15)/b8-6+ |
| InChIKey | ZIGDDTDAWWQNNG-SOFGYWHQSA-N |
| XLogP | 1.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate?
The IUPAC name of methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate (CID 143276796) is methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate.
What is the SMILES notation for methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate?
The canonical SMILES for methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate is C=C/C=C(\C=C)CC(NC(=O)F)C(=O)OC.
What is the InChIKey of methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate?
The InChIKey is ZIGDDTDAWWQNNG-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H14FNO3/c1-4-6-8(5-2)7-9(10(14)16-3)13-11(12)15/h4-6,9H,1-2,7H2,3H3,(H,13,15)/b8-6+.
What are the key properties of methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate?
methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate has a molecular weight of 227.23 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4Z)-2-(carbonofluoridoylamino)-4-ethenylhepta-4,6-dienoate is sourced from PubChem (CID 143276796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).