About CID 143276866
CID 143276866 (PubChem CID 143276866) has the molecular formula C4H7BN2
and a molecular weight of 93.93 g/mol.
Molecular Properties
| Compound Name | CID 143276866 |
| PubChem CID | 143276866 |
| Molecular Formula | C4H7BN2 |
| Molecular Weight | 93.93 g/mol |
| Exact Mass | 94.07 |
| IUPAC Name | — |
| SMILES | [B]C(=C/N)/C=N/C |
| InChI | InChI=1S/C4H7BN2/c1-7-3-4(5)2-6/h2-3H,6H2,1H3/b4-2+,7-3+ |
| InChIKey | CLOKKIQILSGKIH-JKEDICHKSA-N |
| XLogP | -0.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.93 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 143276866 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143276866?
The IUPAC name of CID 143276866 (CID 143276866) is not available.
What is the SMILES notation for CID 143276866?
The canonical SMILES for CID 143276866 is [B]C(=C/N)/C=N/C.
What is the InChIKey of CID 143276866?
The InChIKey is CLOKKIQILSGKIH-JKEDICHKSA-N. The full InChI is InChI=1S/C4H7BN2/c1-7-3-4(5)2-6/h2-3H,6H2,1H3/b4-2+,7-3+.
What are the key properties of CID 143276866?
CID 143276866 has a molecular weight of 93.93 g/mol, XLogP of -0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143276866 is sourced from PubChem (CID 143276866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).