About 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine
3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine (PubChem CID 143277794) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine.
Molecular Properties
| Compound Name | 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine |
| PubChem CID | 143277794 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine |
| SMILES | CCCC(CC)CCc1cccc(C=O)c1.CNC(C)C |
| InChI | InChI=1S/C15H22O.C4H11N/c1-3-6-13(4-2)9-10-14-7-5-8-15(11-14)12-16;1-4(2)5-3/h5,7-8,11-13H,3-4,6,9-10H2,1-2H3;4-5H,1-3H3 |
| InChIKey | PVBOPWQHYXGNND-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine?
The IUPAC name of 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine (CID 143277794) is 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine.
What is the SMILES notation for 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine?
The canonical SMILES for 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine is CCCC(CC)CCc1cccc(C=O)c1.CNC(C)C.
What is the InChIKey of 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine?
The InChIKey is PVBOPWQHYXGNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O.C4H11N/c1-3-6-13(4-2)9-10-14-7-5-8-15(11-14)12-16;1-4(2)5-3/h5,7-8,11-13H,3-4,6,9-10H2,1-2H3;4-5H,1-3H3.
What are the key properties of 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine?
3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine has a molecular weight of 291.48 g/mol, XLogP of 4.87, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylhexyl)benzaldehyde;N-methylpropan-2-amine is sourced from PubChem (CID 143277794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).