C17H20N2O2 — CID 143277863
1-(6-amino-2-methylcyclohexa-1,5-dien-1-yl)-3-(2-amino-6-methylphenyl)propane-1,3-dione (PubChem CID 143277863) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(6-amino-2-methylcyclohexa-1,5-dien-1-yl)-3-(2-amino-6-methylphenyl)propane-1,3-dione.
| Compound Name | 1-(6-amino-2-methylcyclohexa-1,5-dien-1-yl)-3-(2-amino-6-methylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 143277863 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(6-amino-2-methylcyclohexa-1,5-dien-1-yl)-3-(2-amino-6-methylphenyl)propane-1,3-dione |
| SMILES | CC1=C(C(=O)CC(=O)c2c(C)cccc2N)C(N)=CCC1 |
| InChI | InChI=1S/C17H20N2O2/c1-10-5-3-7-12(18)16(10)14(20)9-15(21)17-11(2)6-4-8-13(17)19/h3,5,7-8H,4,6,9,18-19H2,1-2H3 |
| InChIKey | JGMSCEVYUTWJOY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|