C23H33ClO5 — CID 143278591
17-acetyl-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;methanol (PubChem CID 143278591) has the molecular formula C23H33ClO5 and a molecular weight of 424.97 g/mol. Its IUPAC name is 17-acetyl-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;methanol.
| Compound Name | 17-acetyl-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;methanol |
|---|---|
| PubChem CID | 143278591 |
| Molecular Formula | C23H33ClO5 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 17-acetyl-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;methanol |
| SMILES | CC(=O)C1(O)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(O)CC21C.CO |
| InChI | InChI=1S/C22H29ClO4.CH4O/c1-12-9-17-16-6-5-14-10-15(25)7-8-19(14,3)21(16,23)18(26)11-20(17,4)22(12,27)13(2)24;1-2/h7-8,10,12,16-18,26-27H,5-6,9,11H2,1-4H3;2H,1H3 |
| InChIKey | PLCKODUWNQRKFD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|