C25H34ClN7O3 — CID 143278824
N-[5-chloro-6-[3-ethyl-4-[1-(4-hydroxybenzoyl)azepan-4-yl]piperazin-1-yl]-3-(methylamino)pyrazin-2-yl]formamide (PubChem CID 143278824) has the molecular formula C25H34ClN7O3 and a molecular weight of 516.05 g/mol. Its IUPAC name is N-[5-chloro-6-[3-ethyl-4-[1-(4-hydroxybenzoyl)azepan-4-yl]piperazin-1-yl]-3-(methylamino)pyrazin-2-yl]formamide.
| Compound Name | N-[5-chloro-6-[3-ethyl-4-[1-(4-hydroxybenzoyl)azepan-4-yl]piperazin-1-yl]-3-(methylamino)pyrazin-2-yl]formamide |
|---|---|
| PubChem CID | 143278824 |
| Molecular Formula | C25H34ClN7O3 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[5-chloro-6-[3-ethyl-4-[1-(4-hydroxybenzoyl)azepan-4-yl]piperazin-1-yl]-3-(methylamino)pyrazin-2-yl]formamide |
| SMILES | CCC1CN(c2nc(NC=O)c(NC)nc2Cl)CCN1C1CCCN(C(=O)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H34ClN7O3/c1-3-18-15-32(24-21(26)29-22(27-2)23(30-24)28-16-34)13-14-33(18)19-5-4-11-31(12-10-19)25(36)17-6-8-20(35)9-7-17/h6-9,16,18-19,35H,3-5,10-15H2,1-2H3,(H,27,29)(H,28,30,34) |
| InChIKey | OEQUUXDFVGDPAU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|