C22H39FN2 — CID 143279444
1-[(2Z,4Z)-3-fluoro-2,5-dimethylhepta-2,4,6-trienyl]-N-pentan-3-yl-N-propylpiperidin-4-amine (PubChem CID 143279444) has the molecular formula C22H39FN2 and a molecular weight of 350.57 g/mol. Its IUPAC name is 1-[(2Z,4Z)-3-fluoro-2,5-dimethylhepta-2,4,6-trienyl]-N-pentan-3-yl-N-propylpiperidin-4-amine.
| Compound Name | 1-[(2Z,4Z)-3-fluoro-2,5-dimethylhepta-2,4,6-trienyl]-N-pentan-3-yl-N-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 143279444 |
| Molecular Formula | C22H39FN2 |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.31 |
| IUPAC Name | 1-[(2Z,4Z)-3-fluoro-2,5-dimethylhepta-2,4,6-trienyl]-N-pentan-3-yl-N-propylpiperidin-4-amine |
| SMILES | C=C/C(C)=C\C(F)=C(/C)CN1CCC(N(CCC)C(CC)CC)CC1 |
| InChI | InChI=1S/C22H39FN2/c1-7-13-25(20(9-3)10-4)21-11-14-24(15-12-21)17-19(6)22(23)16-18(5)8-2/h8,16,20-21H,2,7,9-15,17H2,1,3-6H3/b18-16-,22-19- |
| InChIKey | WARMZJOHCLNJTR-ZTWBIXGRSA-N |
| XLogP | 5.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|